About 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one
6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one (PubChem CID 69170485) has the molecular formula C19H15FN4O3
and a molecular weight of 366.35 g/mol. Its IUPAC name is 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one |
| PubChem CID | 69170485 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1F.O=c1cc(Nc2ccccc2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H9N3O2.C9H6FNO/c14-9-6-8(12-10(15)13-9)11-7-4-2-1-3-5-7;10-7-5-6-3-1-2-4-8(6)11-9(7)12/h1-6H,(H3,11,12,13,14,15);1-5H,(H,11,12) |
| InChIKey | PEIOBJHKKSTUBC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one?
The IUPAC name of 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one (CID 69170485) is 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one.
What is the SMILES notation for 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one?
The canonical SMILES for 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one is O=c1[nH]c2ccccc2cc1F.O=c1cc(Nc2ccccc2)[nH]c(=O)[nH]1.
What is the InChIKey of 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one?
The InChIKey is PEIOBJHKKSTUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2.C9H6FNO/c14-9-6-8(12-10(15)13-9)11-7-4-2-1-3-5-7;10-7-5-6-3-1-2-4-8(6)11-9(7)12/h1-6H,(H3,11,12,13,14,15);1-5H,(H,11,12).
What are the key properties of 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one?
6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one has a molecular weight of 366.35 g/mol, XLogP of 2.47, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anilino-1H-pyrimidine-2,4-dione;3-fluoro-1H-quinolin-2-one is sourced from PubChem (CID 69170485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).