About 9-bromobenzo[f][2,7]naphthyridin-4-amine
9-bromobenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69170958) has the molecular formula C12H8BrN3
and a molecular weight of 274.12 g/mol. Its IUPAC name is 9-bromobenzo[f][2,7]naphthyridin-4-amine.
Molecular Properties
| Compound Name | 9-bromobenzo[f][2,7]naphthyridin-4-amine |
| PubChem CID | 69170958 |
| Molecular Formula | C12H8BrN3 |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 9-bromobenzo[f][2,7]naphthyridin-4-amine |
| SMILES | Nc1nccc2c1cnc1ccc(Br)cc12 |
| InChI | InChI=1S/C12H8BrN3/c13-7-1-2-11-9(5-7)8-3-4-15-12(14)10(8)6-16-11/h1-6H,(H2,14,15) |
| InChIKey | JJWWMXVCPDMUGW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bromobenzo[f][2,7]naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromobenzo[f][2,7]naphthyridin-4-amine?
The IUPAC name of 9-bromobenzo[f][2,7]naphthyridin-4-amine (CID 69170958) is 9-bromobenzo[f][2,7]naphthyridin-4-amine.
What is the SMILES notation for 9-bromobenzo[f][2,7]naphthyridin-4-amine?
The canonical SMILES for 9-bromobenzo[f][2,7]naphthyridin-4-amine is Nc1nccc2c1cnc1ccc(Br)cc12.
What is the InChIKey of 9-bromobenzo[f][2,7]naphthyridin-4-amine?
The InChIKey is JJWWMXVCPDMUGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN3/c13-7-1-2-11-9(5-7)8-3-4-15-12(14)10(8)6-16-11/h1-6H,(H2,14,15).
What are the key properties of 9-bromobenzo[f][2,7]naphthyridin-4-amine?
9-bromobenzo[f][2,7]naphthyridin-4-amine has a molecular weight of 274.12 g/mol, XLogP of 3.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromobenzo[f][2,7]naphthyridin-4-amine is sourced from PubChem (CID 69170958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).