C21H34FN3O — CID 69171727
3-fluoro-5-methyl-1-N-[1-[(1R,3S)-3-propoxycyclohexyl]piperidin-4-yl]benzene-1,2-diamine (PubChem CID 69171727) has the molecular formula C21H34FN3O and a molecular weight of 363.52 g/mol. Its IUPAC name is 3-fluoro-5-methyl-1-N-[1-[(1R,3S)-3-propoxycyclohexyl]piperidin-4-yl]benzene-1,2-diamine.
| Compound Name | 3-fluoro-5-methyl-1-N-[1-[(1R,3S)-3-propoxycyclohexyl]piperidin-4-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 69171727 |
| Molecular Formula | C21H34FN3O |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | 3-fluoro-5-methyl-1-N-[1-[(1R,3S)-3-propoxycyclohexyl]piperidin-4-yl]benzene-1,2-diamine |
| SMILES | CCCO[C@H]1CCC[C@@H](N2CCC(Nc3cc(C)cc(F)c3N)CC2)C1 |
| InChI | InChI=1S/C21H34FN3O/c1-3-11-26-18-6-4-5-17(14-18)25-9-7-16(8-10-25)24-20-13-15(2)12-19(22)21(20)23/h12-13,16-18,24H,3-11,14,23H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | QZBNBOBRVKPXGQ-MSOLQXFVSA-N |
| XLogP | 4.33 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|