C18H19N5O2S — CID 69171777
2-[[2-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-6-yl]methyl]piperazine-1-carboxylic acid (PubChem CID 69171777) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[[2-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-6-yl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 2-[[2-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-6-yl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69171777 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[[2-(2-aminophenyl)-[1,3]thiazolo[5,4-b]pyridin-6-yl]methyl]piperazine-1-carboxylic acid |
| SMILES | Nc1ccccc1-c1nc2cc(CC3CNCCN3C(=O)O)cnc2s1 |
| InChI | InChI=1S/C18H19N5O2S/c19-14-4-2-1-3-13(14)16-22-15-8-11(9-21-17(15)26-16)7-12-10-20-5-6-23(12)18(24)25/h1-4,8-9,12,20H,5-7,10,19H2,(H,24,25) |
| InChIKey | WPPGWQKEGQIKOH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|