C22H31FN2O6 — CID 69172029
benzyl N-[1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 69172029) has the molecular formula C22H31FN2O6 and a molecular weight of 438.50 g/mol. Its IUPAC name is benzyl N-[1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 69172029 |
| Molecular Formula | C22H31FN2O6 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | benzyl N-[1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | COC1(OC)CO[C@H]2[C@@H]1N(C(=O)C(CC(C)C)NC(=O)OCc1ccccc1)C[C@@H]2F |
| InChI | InChI=1S/C22H31FN2O6/c1-14(2)10-17(24-21(27)30-12-15-8-6-5-7-9-15)20(26)25-11-16(23)18-19(25)22(28-3,29-4)13-31-18/h5-9,14,16-19H,10-13H2,1-4H3,(H,24,27)/t16-,17?,18+,19-/m0/s1 |
| InChIKey | XVJQTGNGPLUWPP-GWAVRBHSSA-N |
| XLogP | 2.26 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|