C7H12N4S — CID 6917212
2-N-cyclopentyl-1,3,4-thiadiazole-2,5-diamine (PubChem CID 6917212) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 2-N-cyclopentyl-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N-cyclopentyl-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 6917212 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-N-cyclopentyl-1,3,4-thiadiazole-2,5-diamine |
| SMILES | Nc1nnc(NC2CCCC2)s1 |
| InChI | InChI=1S/C7H12N4S/c8-6-10-11-7(12-6)9-5-3-1-2-4-5/h5H,1-4H2,(H2,8,10)(H,9,11) |
| InChIKey | FGCINSNMIOPLLZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |