About 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one
3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one (PubChem CID 69172167) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one |
| PubChem CID | 69172167 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2c(n1C1CCNCC1)CCC=C2 |
| InChI | InChI=1S/C12H17N3O/c16-12-14-10-3-1-2-4-11(10)15(12)9-5-7-13-8-6-9/h1,3,9,13H,2,4-8H2,(H,14,16) |
| InChIKey | MCSFUWOTYWTKOU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one?
The IUPAC name of 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one (CID 69172167) is 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one.
What is the SMILES notation for 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one?
The canonical SMILES for 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one is O=c1[nH]c2c(n1C1CCNCC1)CCC=C2.
What is the InChIKey of 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one?
The InChIKey is MCSFUWOTYWTKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c16-12-14-10-3-1-2-4-11(10)15(12)9-5-7-13-8-6-9/h1,3,9,13H,2,4-8H2,(H,14,16).
What are the key properties of 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one?
3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one has a molecular weight of 219.29 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-yl-4,5-dihydro-1H-benzimidazol-2-one is sourced from PubChem (CID 69172167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).