C7H12N4O4S — CID 6917264
(2S,4R,5R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 6917264) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is (2S,4R,5R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,4R,5R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 6917264 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (2S,4R,5R)-2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(S[C@@H]2O[C@H](CO)[C@H](O)C2O)n[nH]1 |
| InChI | InChI=1S/C7H12N4O4S/c8-6-9-7(11-10-6)16-5-4(14)3(13)2(1-12)15-5/h2-5,12-14H,1H2,(H3,8,9,10,11)/t2-,3+,4?,5+/m1/s1 |
| InChIKey | VGTFUOANHCPLNA-UOFNXBMGSA-N |
| XLogP | -2.08 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |