About 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid
2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 69172890) has the molecular formula C12H17NO9S
and a molecular weight of 351.33 g/mol. Its IUPAC name is 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| PubChem CID | 69172890 |
| Molecular Formula | C12H17NO9S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)OC1=C(O)C(C(O)CO)OC1=O)C(=O)O |
| InChI | InChI=1S/C12H17NO9S/c1-23-3-2-5(10(17)18)13-12(20)22-9-7(16)8(6(15)4-14)21-11(9)19/h5-6,8,14-16H,2-4H2,1H3,(H,13,20)(H,17,18) |
| InChIKey | QIVQIJBMMRZIHD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid?
The IUPAC name of 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid (CID 69172890) is 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid.
What is the SMILES notation for 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid?
The canonical SMILES for 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid is CSCCC(NC(=O)OC1=C(O)C(C(O)CO)OC1=O)C(=O)O.
What is the InChIKey of 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid?
The InChIKey is QIVQIJBMMRZIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO9S/c1-23-3-2-5(10(17)18)13-12(20)22-9-7(16)8(6(15)4-14)21-11(9)19/h5-6,8,14-16H,2-4H2,1H3,(H,13,20)(H,17,18).
What are the key properties of 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid?
2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid has a molecular weight of 351.33 g/mol, XLogP of -1.03, 8 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 69172890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).