About ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate
ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate (PubChem CID 691731) has the molecular formula C19H15NO4
and a molecular weight of 321.33 g/mol. Its IUPAC name is ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate |
| PubChem CID | 691731 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC2=CC(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H15NO4/c1-2-24-19(23)12-7-9-13(10-8-12)20-16-11-17(21)18(22)15-6-4-3-5-14(15)16/h3-11,20H,2H2,1H3 |
| InChIKey | BJFPPILHFRTJTD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate?
The IUPAC name of ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate (CID 691731) is ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate.
What is the SMILES notation for ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate?
The canonical SMILES for ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate is CCOC(=O)c1ccc(NC2=CC(=O)C(=O)c3ccccc32)cc1.
What is the InChIKey of ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate?
The InChIKey is BJFPPILHFRTJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO4/c1-2-24-19(23)12-7-9-13(10-8-12)20-16-11-17(21)18(22)15-6-4-3-5-14(15)16/h3-11,20H,2H2,1H3.
What are the key properties of ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate?
ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate has a molecular weight of 321.33 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3,4-dioxonaphthalen-1-yl)amino]benzoate is sourced from PubChem (CID 691731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).