C42H40N4O8 — CID 6917325
(3S,14S,17S,28S)-14,28-bis(3,4,5-trimethoxyphenyl)-1,12,15,26-tetrazaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.020,25]octacosa-5(13),6,8,10,19(27),20,22,24-octaene-2,16-dione (PubChem CID 6917325) has the molecular formula C42H40N4O8 and a molecular weight of 728.80 g/mol. Its IUPAC name is (3S,14S,17S,28S)-14,28-bis(3,4,5-trimethoxyphenyl)-1,12,15,26-tetrazaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.020,25]octacosa-5(13),6,8,10,19(27),20,22,24-octaene-2,16-dione.
| Compound Name | (3S,14S,17S,28S)-14,28-bis(3,4,5-trimethoxyphenyl)-1,12,15,26-tetrazaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.020,25]octacosa-5(13),6,8,10,19(27),20,22,24-octaene-2,16-dione |
|---|---|
| PubChem CID | 6917325 |
| Molecular Formula | C42H40N4O8 |
| Molecular Weight | 728.80 g/mol |
| Exact Mass | 728.28 |
| IUPAC Name | (3S,14S,17S,28S)-14,28-bis(3,4,5-trimethoxyphenyl)-1,12,15,26-tetrazaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.020,25]octacosa-5(13),6,8,10,19(27),20,22,24-octaene-2,16-dione |
| SMILES | COc1cc([C@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N4[C@@H](c5cc(OC)c(OC)c(OC)c5)c5[nH]c6ccccc6c5C[C@H]4C(=O)N23)cc(OC)c1OC |
| InChI | InChI=1S/C42H40N4O8/c1-49-31-15-21(16-32(50-2)39(31)53-5)37-35-25(23-11-7-9-13-27(23)43-35)19-29-42(48)46-30(41(47)45(29)37)20-26-24-12-8-10-14-28(24)44-36(26)38(46)22-17-33(51-3)40(54-6)34(18-22)52-4/h7-18,29-30,37-38,43-44H,19-20H2,1-6H3/t29-,30-,37-,38-/m0/s1 |
| InChIKey | OOPKIUNZALUBEF-GBXZDHDHSA-N |
| XLogP | 6.10 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.80 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|