C17H20O4 — CID 6917339
(1aR,3R,4R,7aS)-4-butyl-3-hydroxy-7a-prop-2-enyl-3,4-dihydro-1aH-naphtho[2,3-b]oxirene-2,7-dione (PubChem CID 6917339) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1aR,3R,4R,7aS)-4-butyl-3-hydroxy-7a-prop-2-enyl-3,4-dihydro-1aH-naphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | (1aR,3R,4R,7aS)-4-butyl-3-hydroxy-7a-prop-2-enyl-3,4-dihydro-1aH-naphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 6917339 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1aR,3R,4R,7aS)-4-butyl-3-hydroxy-7a-prop-2-enyl-3,4-dihydro-1aH-naphtho[2,3-b]oxirene-2,7-dione |
| SMILES | C=CC[C@]12O[C@H]1C(=O)C1=C(C=C[C@@H](CCCC)[C@H]1O)C2=O |
| InChI | InChI=1S/C17H20O4/c1-3-5-6-10-7-8-11-12(13(10)18)14(19)16-17(21-16,9-4-2)15(11)20/h4,7-8,10,13,16,18H,2-3,5-6,9H2,1H3/t10-,13-,16+,17-/m1/s1 |
| InChIKey | QDTKAVGZIQOPMC-ZLDMJSGGSA-N |
| XLogP | 1.89 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|