2-oxooxane-4-carboxylic acid

C6H8O4 — CID 69173486

IUPAC2-oxooxane-4-carboxylic acid
SMILESO=C1CC(C(=O)O)CCO1
InChIInChI=1S/C6H8O4/c7-5-3-4(6(8)9)1-2-10-5/h4H,1-3H2,(H,8,9)
InChIKeyPYQFNPKJTAJEOQ-UHFFFAOYSA-N
MW144.13 g/mol
LogP0.02
Rot. Bonds1

About 2-oxooxane-4-carboxylic acid

2-oxooxane-4-carboxylic acid (PubChem CID 69173486) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is 2-oxooxane-4-carboxylic acid.

Molecular Properties

Compound Name2-oxooxane-4-carboxylic acid
PubChem CID69173486
Molecular FormulaC6H8O4
Molecular Weight144.13 g/mol
Exact Mass144.04
IUPAC Name2-oxooxane-4-carboxylic acid
SMILESO=C1CC(C(=O)O)CCO1
InChIInChI=1S/C6H8O4/c7-5-3-4(6(8)9)1-2-10-5/h4H,1-3H2,(H,8,9)
InChIKeyPYQFNPKJTAJEOQ-UHFFFAOYSA-N
XLogP0.02
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.13
LogP ≤ 50.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-oxooxane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxooxane-4-carboxylic acid?
The IUPAC name of 2-oxooxane-4-carboxylic acid (CID 69173486) is 2-oxooxane-4-carboxylic acid.
What is the SMILES notation for 2-oxooxane-4-carboxylic acid?
The canonical SMILES for 2-oxooxane-4-carboxylic acid is O=C1CC(C(=O)O)CCO1.
What is the InChIKey of 2-oxooxane-4-carboxylic acid?
The InChIKey is PYQFNPKJTAJEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c7-5-3-4(6(8)9)1-2-10-5/h4H,1-3H2,(H,8,9).
What are the key properties of 2-oxooxane-4-carboxylic acid?
2-oxooxane-4-carboxylic acid has a molecular weight of 144.13 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxooxane-4-carboxylic acid is sourced from PubChem (CID 69173486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).