About 2-oxooxane-4-carboxylic acid
2-oxooxane-4-carboxylic acid (PubChem CID 69173486) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 2-oxooxane-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxooxane-4-carboxylic acid |
| PubChem CID | 69173486 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2-oxooxane-4-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)CCO1 |
| InChI | InChI=1S/C6H8O4/c7-5-3-4(6(8)9)1-2-10-5/h4H,1-3H2,(H,8,9) |
| InChIKey | PYQFNPKJTAJEOQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxooxane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxooxane-4-carboxylic acid?
The IUPAC name of 2-oxooxane-4-carboxylic acid (CID 69173486) is 2-oxooxane-4-carboxylic acid.
What is the SMILES notation for 2-oxooxane-4-carboxylic acid?
The canonical SMILES for 2-oxooxane-4-carboxylic acid is O=C1CC(C(=O)O)CCO1.
What is the InChIKey of 2-oxooxane-4-carboxylic acid?
The InChIKey is PYQFNPKJTAJEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c7-5-3-4(6(8)9)1-2-10-5/h4H,1-3H2,(H,8,9).
What are the key properties of 2-oxooxane-4-carboxylic acid?
2-oxooxane-4-carboxylic acid has a molecular weight of 144.13 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxooxane-4-carboxylic acid is sourced from PubChem (CID 69173486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).