C15H21NO — CID 69173638
6-benzyl-4a-methyl-2,3,4,5,7,7a-hexahydropyrano[2,3-c]pyrrole (PubChem CID 69173638) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 6-benzyl-4a-methyl-2,3,4,5,7,7a-hexahydropyrano[2,3-c]pyrrole.
| Compound Name | 6-benzyl-4a-methyl-2,3,4,5,7,7a-hexahydropyrano[2,3-c]pyrrole |
|---|---|
| PubChem CID | 69173638 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 6-benzyl-4a-methyl-2,3,4,5,7,7a-hexahydropyrano[2,3-c]pyrrole |
| SMILES | CC12CCCOC1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C15H21NO/c1-15-8-5-9-17-14(15)11-16(12-15)10-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3 |
| InChIKey | PNUCAJBYKPBDNH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |