C15H22N2O2 — CID 69173839
(3S)-5-(2-pyrrolidin-2-ylethoxy)-3,4-dihydro-2H-chromen-3-amine (PubChem CID 69173839) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3S)-5-(2-pyrrolidin-2-ylethoxy)-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (3S)-5-(2-pyrrolidin-2-ylethoxy)-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 69173839 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (3S)-5-(2-pyrrolidin-2-ylethoxy)-3,4-dihydro-2H-chromen-3-amine |
| SMILES | N[C@@H]1COc2cccc(OCCC3CCCN3)c2C1 |
| InChI | InChI=1S/C15H22N2O2/c16-11-9-13-14(4-1-5-15(13)19-10-11)18-8-6-12-3-2-7-17-12/h1,4-5,11-12,17H,2-3,6-10,16H2/t11-,12?/m0/s1 |
| InChIKey | LMNNBQGHVZGGFL-PXYINDEMSA-N |
| XLogP | 1.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |