C10H9NO2 — CID 69173889
5,8-dimethylpyrano[2,3-c]pyridin-2-one (PubChem CID 69173889) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5,8-dimethylpyrano[2,3-c]pyridin-2-one.
| Compound Name | 5,8-dimethylpyrano[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 69173889 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5,8-dimethylpyrano[2,3-c]pyridin-2-one |
| SMILES | Cc1cnc(C)c2oc(=O)ccc12 |
| InChI | InChI=1S/C10H9NO2/c1-6-5-11-7(2)10-8(6)3-4-9(12)13-10/h3-5H,1-2H3 |
| InChIKey | CVRIFJCCNMWDIU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |