C14H9FN4O2 — CID 69173933
2-fluoro-5-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzonitrile;formic acid (PubChem CID 69173933) has the molecular formula C14H9FN4O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is 2-fluoro-5-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzonitrile;formic acid.
| Compound Name | 2-fluoro-5-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzonitrile;formic acid |
|---|---|
| PubChem CID | 69173933 |
| Molecular Formula | C14H9FN4O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-fluoro-5-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzonitrile;formic acid |
| SMILES | N#Cc1cc(-c2ccnc3[nH]ncc23)ccc1F.O=CO |
| InChI | InChI=1S/C13H7FN4.CH2O2/c14-12-2-1-8(5-9(12)6-15)10-3-4-16-13-11(10)7-17-18-13;2-1-3/h1-5,7H,(H,16,17,18);1H,(H,2,3) |
| InChIKey | YDJPBNVPOVTXGP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|