C10H10O4 — CID 6917396
(1S,6R)-3-(hydroxymethyl)-4-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 6917396) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (1S,6R)-3-(hydroxymethyl)-4-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | (1S,6R)-3-(hydroxymethyl)-4-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 6917396 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (1S,6R)-3-(hydroxymethyl)-4-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | C/C=C/C1=C(CO)C(=O)[C@H]2O[C@H]2C1=O |
| InChI | InChI=1S/C10H10O4/c1-2-3-5-6(4-11)8(13)10-9(14-10)7(5)12/h2-3,9-11H,4H2,1H3/b3-2+/t9-,10+/m0/s1 |
| InChIKey | MBCPVQLLSPBHSA-MDCNRGEUSA-N |
| XLogP | -0.23 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|