C23H29NO5S — CID 6917416
methyl (E,5S,6R)-5-methyl-6-[(4-methylphenyl)sulfonylamino]-7-phenylmethoxyhept-3-enoate (PubChem CID 6917416) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is methyl (E,5S,6R)-5-methyl-6-[(4-methylphenyl)sulfonylamino]-7-phenylmethoxyhept-3-enoate.
| Compound Name | methyl (E,5S,6R)-5-methyl-6-[(4-methylphenyl)sulfonylamino]-7-phenylmethoxyhept-3-enoate |
|---|---|
| PubChem CID | 6917416 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | methyl (E,5S,6R)-5-methyl-6-[(4-methylphenyl)sulfonylamino]-7-phenylmethoxyhept-3-enoate |
| SMILES | COC(=O)C/C=C/[C@H](C)[C@H](COCc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29NO5S/c1-18-12-14-21(15-13-18)30(26,27)24-22(19(2)8-7-11-23(25)28-3)17-29-16-20-9-5-4-6-10-20/h4-10,12-15,19,22,24H,11,16-17H2,1-3H3/b8-7+/t19-,22-/m0/s1 |
| InChIKey | WZVYGSARQPLHAZ-CPVCZIGASA-N |
| XLogP | 3.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|