About 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol
1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol (PubChem CID 69174303) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol |
| PubChem CID | 69174303 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol |
| SMILES | CC1=CC(C)=NC(O)N1CCO |
| InChI | InChI=1S/C8H14N2O2/c1-6-5-7(2)10(3-4-11)8(12)9-6/h5,8,11-12H,3-4H2,1-2H3 |
| InChIKey | HYQYMEOUHVLQCR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol?
The IUPAC name of 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol (CID 69174303) is 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol.
What is the SMILES notation for 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol?
The canonical SMILES for 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol is CC1=CC(C)=NC(O)N1CCO.
What is the InChIKey of 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol?
The InChIKey is HYQYMEOUHVLQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6-5-7(2)10(3-4-11)8(12)9-6/h5,8,11-12H,3-4H2,1-2H3.
What are the key properties of 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol?
1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol has a molecular weight of 170.21 g/mol, XLogP of -0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-4,6-dimethyl-2H-pyrimidin-2-ol is sourced from PubChem (CID 69174303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).