C16H24O5 — CID 6917459
(4E,6S,11E,13R,14S)-14-methoxy-6,13-dimethyl-1,8-dioxacyclopentadeca-4,11-diene-2,9-dione (PubChem CID 6917459) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (4E,6S,11E,13R,14S)-14-methoxy-6,13-dimethyl-1,8-dioxacyclopentadeca-4,11-diene-2,9-dione.
| Compound Name | (4E,6S,11E,13R,14S)-14-methoxy-6,13-dimethyl-1,8-dioxacyclopentadeca-4,11-diene-2,9-dione |
|---|---|
| PubChem CID | 6917459 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (4E,6S,11E,13R,14S)-14-methoxy-6,13-dimethyl-1,8-dioxacyclopentadeca-4,11-diene-2,9-dione |
| SMILES | CO[C@@H]1COC(=O)C/C=C/[C@H](C)COC(=O)C/C=C/[C@H]1C |
| InChI | InChI=1S/C16H24O5/c1-12-6-4-8-16(18)21-11-14(19-3)13(2)7-5-9-15(17)20-10-12/h4-7,12-14H,8-11H2,1-3H3/b6-4+,7-5+/t12-,13+,14+/m0/s1 |
| InChIKey | FXDCAHNBWPITKH-HEWXFWOWSA-N |
| XLogP | 2.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|