C27H29N5O4 — CID 69174982
N-[2-(diethylamino)ethyl]-2-methyl-4-(2-nitrophenyl)-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide (PubChem CID 69174982) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-methyl-4-(2-nitrophenyl)-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-methyl-4-(2-nitrophenyl)-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 69174982 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-methyl-4-(2-nitrophenyl)-5-[(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(C=C2C(=O)Nc3ccccc32)c1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H29N5O4/c1-4-31(5-2)15-14-28-27(34)24-17(3)29-22(25(24)19-11-7-9-13-23(19)32(35)36)16-20-18-10-6-8-12-21(18)30-26(20)33/h6-13,16,29H,4-5,14-15H2,1-3H3,(H,28,34)(H,30,33) |
| InChIKey | QZDIMYXMAFNRTO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|