C23H22N4O4 — CID 69175057
2,4-diamino-2,6-bis(2-methoxyphenyl)quinazoline-6-carboxylic acid (PubChem CID 69175057) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2,4-diamino-2,6-bis(2-methoxyphenyl)quinazoline-6-carboxylic acid.
| Compound Name | 2,4-diamino-2,6-bis(2-methoxyphenyl)quinazoline-6-carboxylic acid |
|---|---|
| PubChem CID | 69175057 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2,4-diamino-2,6-bis(2-methoxyphenyl)quinazoline-6-carboxylic acid |
| SMILES | COc1ccccc1C1(N)N=C(N)C2=CC(C(=O)O)(c3ccccc3OC)C=CC2=N1 |
| InChI | InChI=1S/C23H22N4O4/c1-30-18-9-5-3-7-15(18)22(21(28)29)12-11-17-14(13-22)20(24)27-23(25,26-17)16-8-4-6-10-19(16)31-2/h3-13H,25H2,1-2H3,(H2,24,27)(H,28,29) |
| InChIKey | DUWZDOSTNWOKTI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |