C12H6N4 — CID 69176447
3,10,12,14-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 69176447) has the molecular formula C12H6N4 and a molecular weight of 206.21 g/mol. Its IUPAC name is 3,10,12,14-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 3,10,12,14-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 69176447 |
| Molecular Formula | C12H6N4 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3,10,12,14-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=Nc2cc3c4c(ccc3nc2=N1)=CC=N4 |
| InChI | InChI=1S/C12H6N4/c1-2-9-8(11-7(1)3-4-13-11)5-10-12(16-9)15-6-14-10/h1-6H |
| InChIKey | AMBZNXNKAKZDHN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |