C21H21NO5 — CID 69176470
methyl 2-[(3S)-4-oxopent-1-en-3-yl]-3-(phenylmethoxycarbonylamino)benzoate (PubChem CID 69176470) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl 2-[(3S)-4-oxopent-1-en-3-yl]-3-(phenylmethoxycarbonylamino)benzoate.
| Compound Name | methyl 2-[(3S)-4-oxopent-1-en-3-yl]-3-(phenylmethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 69176470 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl 2-[(3S)-4-oxopent-1-en-3-yl]-3-(phenylmethoxycarbonylamino)benzoate |
| SMILES | C=C[C@H](C(C)=O)c1c(NC(=O)OCc2ccccc2)cccc1C(=O)OC |
| InChI | InChI=1S/C21H21NO5/c1-4-16(14(2)23)19-17(20(24)26-3)11-8-12-18(19)22-21(25)27-13-15-9-6-5-7-10-15/h4-12,16H,1,13H2,2-3H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | SUBPWUKBBDPHCW-MRXNPFEDSA-N |
| XLogP | 4.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|