C31H48N2O5 — CID 69176475
tert-butyl N-[(1S,3S)-4-(1H-indol-6-yl)-7-methoxy-1-[(4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylheptyl]carbamate (PubChem CID 69176475) has the molecular formula C31H48N2O5 and a molecular weight of 528.73 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-4-(1H-indol-6-yl)-7-methoxy-1-[(4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylheptyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-4-(1H-indol-6-yl)-7-methoxy-1-[(4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylheptyl]carbamate |
|---|---|
| PubChem CID | 69176475 |
| Molecular Formula | C31H48N2O5 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | tert-butyl N-[(1S,3S)-4-(1H-indol-6-yl)-7-methoxy-1-[(4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylheptyl]carbamate |
| SMILES | COCCCC(c1ccc2cc[nH]c2c1)[C@@H](C[C@H](NC(=O)OC(C)(C)C)C1C[C@@H](C(C)C)C(=O)O1)C(C)C |
| InChI | InChI=1S/C31H48N2O5/c1-19(2)24(23(10-9-15-36-8)22-12-11-21-13-14-32-26(21)16-22)17-27(33-30(35)38-31(5,6)7)28-18-25(20(3)4)29(34)37-28/h11-14,16,19-20,23-25,27-28,32H,9-10,15,17-18H2,1-8H3,(H,33,35)/t23?,24-,25-,27-,28?/m0/s1 |
| InChIKey | VQKDDQXLCVBYNN-MAOTVWPSSA-N |
| XLogP | 6.82 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|