About 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol
3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol (PubChem CID 6917663) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol.
Molecular Properties
| Compound Name | 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol |
| PubChem CID | 6917663 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol |
| SMILES | CCC[C@@]1(c2cccc(O)c2)CCN(C)C[C@H]1C |
| InChI | InChI=1S/C16H25NO/c1-4-8-16(9-10-17(3)12-13(16)2)14-6-5-7-15(18)11-14/h5-7,11,13,18H,4,8-10,12H2,1-3H3/t13-,16-/m1/s1 |
| InChIKey | RTOHPIRUUAKHOZ-CZUORRHYSA-N |
| XLogP | 3.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol?
The IUPAC name of 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol (CID 6917663) is 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol.
What is the SMILES notation for 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol?
The canonical SMILES for 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol is CCC[C@@]1(c2cccc(O)c2)CCN(C)C[C@H]1C.
What is the InChIKey of 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol?
The InChIKey is RTOHPIRUUAKHOZ-CZUORRHYSA-N. The full InChI is InChI=1S/C16H25NO/c1-4-8-16(9-10-17(3)12-13(16)2)14-6-5-7-15(18)11-14/h5-7,11,13,18H,4,8-10,12H2,1-3H3/t13-,16-/m1/s1.
What are the key properties of 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol?
3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol has a molecular weight of 247.38 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol is sourced from PubChem (CID 6917663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).