About acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate
acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate (PubChem CID 69176768) has the molecular formula C15H23NO7
and a molecular weight of 329.35 g/mol. Its IUPAC name is acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate.
Molecular Properties
| Compound Name | acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate |
| PubChem CID | 69176768 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate |
| SMILES | CC(=O)O.Cc1oc(=O)oc1COC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C13H19NO5.C2H4O2/c1-9-11(19-13(16)18-9)8-17-12(15)14-7-10-5-3-2-4-6-10;1-2(3)4/h10H,2-8H2,1H3,(H,14,15);1H3,(H,3,4) |
| InChIKey | FKFHNJXRDMFETL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate?
The IUPAC name of acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate (CID 69176768) is acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate.
What is the SMILES notation for acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate?
The canonical SMILES for acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate is CC(=O)O.Cc1oc(=O)oc1COC(=O)NCC1CCCCC1.
What is the InChIKey of acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate?
The InChIKey is FKFHNJXRDMFETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5.C2H4O2/c1-9-11(19-13(16)18-9)8-17-12(15)14-7-10-5-3-2-4-6-10;1-2(3)4/h10H,2-8H2,1H3,(H,14,15);1H3,(H,3,4).
What are the key properties of acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate?
acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate has a molecular weight of 329.35 g/mol, XLogP of 2.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl N-(cyclohexylmethyl)carbamate is sourced from PubChem (CID 69176768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).