About 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole
4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole (PubChem CID 69176846) has the molecular formula C19H16F3NOS
and a molecular weight of 363.40 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole.
Molecular Properties
| Compound Name | 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole |
| PubChem CID | 69176846 |
| Molecular Formula | C19H16F3NOS |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole |
| SMILES | COc1ccccc1-c1c(C(F)(F)F)nsc1CCc1ccccc1 |
| InChI | InChI=1S/C19H16F3NOS/c1-24-15-10-6-5-9-14(15)17-16(25-23-18(17)19(20,21)22)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3 |
| InChIKey | VJLAPZHVEOAXNJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole?
The IUPAC name of 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole (CID 69176846) is 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole.
What is the SMILES notation for 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole?
The canonical SMILES for 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole is COc1ccccc1-c1c(C(F)(F)F)nsc1CCc1ccccc1.
What is the InChIKey of 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole?
The InChIKey is VJLAPZHVEOAXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3NOS/c1-24-15-10-6-5-9-14(15)17-16(25-23-18(17)19(20,21)22)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3.
What are the key properties of 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole?
4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole has a molecular weight of 363.40 g/mol, XLogP of 5.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyphenyl)-5-(2-phenylethyl)-3-(trifluoromethyl)-1,2-thiazole is sourced from PubChem (CID 69176846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).