About 4-chloropyrazole-1,3-diamine
4-chloropyrazole-1,3-diamine (PubChem CID 69177040) has the molecular formula C3H5ClN4
and a molecular weight of 132.55 g/mol. Its IUPAC name is 4-chloropyrazole-1,3-diamine.
Molecular Properties
| Compound Name | 4-chloropyrazole-1,3-diamine |
| PubChem CID | 69177040 |
| Molecular Formula | C3H5ClN4 |
| Molecular Weight | 132.55 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 4-chloropyrazole-1,3-diamine |
| SMILES | Nc1nn(N)cc1Cl |
| InChI | InChI=1S/C3H5ClN4/c4-2-1-8(6)7-3(2)5/h1H,6H2,(H2,5,7) |
| InChIKey | BTGFQKDMLWJHIG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.55 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloropyrazole-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyrazole-1,3-diamine?
The IUPAC name of 4-chloropyrazole-1,3-diamine (CID 69177040) is 4-chloropyrazole-1,3-diamine.
What is the SMILES notation for 4-chloropyrazole-1,3-diamine?
The canonical SMILES for 4-chloropyrazole-1,3-diamine is Nc1nn(N)cc1Cl.
What is the InChIKey of 4-chloropyrazole-1,3-diamine?
The InChIKey is BTGFQKDMLWJHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClN4/c4-2-1-8(6)7-3(2)5/h1H,6H2,(H2,5,7).
What are the key properties of 4-chloropyrazole-1,3-diamine?
4-chloropyrazole-1,3-diamine has a molecular weight of 132.55 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyrazole-1,3-diamine is sourced from PubChem (CID 69177040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).