C21H22O3 — CID 69177503
2-[6-[2-(4-methoxyphenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid (PubChem CID 69177503) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[6-[2-(4-methoxyphenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[6-[2-(4-methoxyphenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 69177503 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-[6-[2-(4-methoxyphenyl)ethenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
| SMILES | COc1ccc(C=Cc2ccc3c(c2)CCCC3CC(=O)O)cc1 |
| InChI | InChI=1S/C21H22O3/c1-24-19-10-7-15(8-11-19)5-6-16-9-12-20-17(13-16)3-2-4-18(20)14-21(22)23/h5-13,18H,2-4,14H2,1H3,(H,22,23) |
| InChIKey | ZARSXVGZNFHDAA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|