C29H37N3O3 — CID 69177833
methyl 4-[[4-(3-cyclohexyl-2-oxo-5-phenylimidazolidin-1-yl)piperidin-1-yl]methyl]benzoate (PubChem CID 69177833) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is methyl 4-[[4-(3-cyclohexyl-2-oxo-5-phenylimidazolidin-1-yl)piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(3-cyclohexyl-2-oxo-5-phenylimidazolidin-1-yl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 69177833 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | methyl 4-[[4-(3-cyclohexyl-2-oxo-5-phenylimidazolidin-1-yl)piperidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCC(N3C(=O)N(C4CCCCC4)CC3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H37N3O3/c1-35-28(33)24-14-12-22(13-15-24)20-30-18-16-26(17-19-30)32-27(23-8-4-2-5-9-23)21-31(29(32)34)25-10-6-3-7-11-25/h2,4-5,8-9,12-15,25-27H,3,6-7,10-11,16-21H2,1H3 |
| InChIKey | YUOHPVOIONIHEW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |