C23H26N6O — CID 69177982
N-[(1S,2S)-2-aminocyclohexyl]-4-[[6-(3-aminophenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 69177982) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[(1S,2S)-2-aminocyclohexyl]-4-[[6-(3-aminophenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-[(1S,2S)-2-aminocyclohexyl]-4-[[6-(3-aminophenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 69177982 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-[(1S,2S)-2-aminocyclohexyl]-4-[[6-(3-aminophenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | Nc1cccc(-c2cc(Nc3ccc(C(=O)N[C@H]4CCCC[C@@H]4N)cc3)ncn2)c1 |
| InChI | InChI=1S/C23H26N6O/c24-17-5-3-4-16(12-17)21-13-22(27-14-26-21)28-18-10-8-15(9-11-18)23(30)29-20-7-2-1-6-19(20)25/h3-5,8-14,19-20H,1-2,6-7,24-25H2,(H,29,30)(H,26,27,28)/t19-,20-/m0/s1 |
| InChIKey | ZNTGOXCFPMKVNI-PMACEKPBSA-N |
| XLogP | 3.47 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|