About 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one
6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one (PubChem CID 69178027) has the molecular formula C21H17Cl2N3O3
and a molecular weight of 430.29 g/mol. Its IUPAC name is 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one |
| PubChem CID | 69178027 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one |
| SMILES | O=C1OC2(CCNCC2)c2cc(Cl)ccc2N1C(=O)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H17Cl2N3O3/c22-12-2-4-18-16(9-12)21(5-7-24-8-6-21)29-20(28)26(18)19(27)15-11-25-17-10-13(23)1-3-14(15)17/h1-4,9-11,24-25H,5-8H2 |
| InChIKey | PBLLQZHPRQNGNU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one?
The IUPAC name of 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one (CID 69178027) is 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one.
What is the SMILES notation for 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one?
The canonical SMILES for 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one is O=C1OC2(CCNCC2)c2cc(Cl)ccc2N1C(=O)c1c[nH]c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one?
The InChIKey is PBLLQZHPRQNGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl2N3O3/c22-12-2-4-18-16(9-12)21(5-7-24-8-6-21)29-20(28)26(18)19(27)15-11-25-17-10-13(23)1-3-14(15)17/h1-4,9-11,24-25H,5-8H2.
What are the key properties of 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one?
6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one has a molecular weight of 430.29 g/mol, XLogP of 4.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-(6-chloro-1H-indole-3-carbonyl)spiro[3,1-benzoxazine-4,4'-piperidine]-2-one is sourced from PubChem (CID 69178027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).