About 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate
4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate (PubChem CID 6917809) has the molecular formula C21H39ClNO4P
and a molecular weight of 435.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate |
| PubChem CID | 6917809 |
| Molecular Formula | C21H39ClNO4P |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate |
| SMILES | CCCCCCC[N+](CC)(CC)CCCCc1ccc(Cl)cc1.O=P([O-])(O)O |
| InChI | InChI=1S/C21H37ClN.H3O4P/c1-4-7-8-9-11-18-23(5-2,6-3)19-12-10-13-20-14-16-21(22)17-15-20;1-5(2,3)4/h14-17H,4-13,18-19H2,1-3H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | HBLQZEWZVJXHKQ-UHFFFAOYSA-M |
| XLogP | 4.93 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate?
The IUPAC name of 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate (CID 6917809) is 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate.
What is the SMILES notation for 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate?
The canonical SMILES for 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate is CCCCCCC[N+](CC)(CC)CCCCc1ccc(Cl)cc1.O=P([O-])(O)O.
What is the InChIKey of 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate?
The InChIKey is HBLQZEWZVJXHKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H37ClN.H3O4P/c1-4-7-8-9-11-18-23(5-2,6-3)19-12-10-13-20-14-16-21(22)17-15-20;1-5(2,3)4/h14-17H,4-13,18-19H2,1-3H3;(H3,1,2,3,4)/q+1;/p-1.
What are the key properties of 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate?
4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate has a molecular weight of 435.97 g/mol, XLogP of 4.93, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)butyl-diethyl-heptylazanium;dihydrogen phosphate is sourced from PubChem (CID 6917809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).