About N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine
N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine (PubChem CID 69178137) has the molecular formula C28H45NS2
and a molecular weight of 459.81 g/mol. Its IUPAC name is N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine.
Molecular Properties
| Compound Name | N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine |
| PubChem CID | 69178137 |
| Molecular Formula | C28H45NS2 |
| Molecular Weight | 459.81 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine |
| SMILES | CC(C)CCCCCCCC(C)CCCC=CC(C)(C)c1ccsc1Nc1cccs1 |
| InChI | InChI=1S/C28H45NS2/c1-23(2)15-10-7-6-8-11-16-24(3)17-12-9-13-20-28(4,5)25-19-22-31-27(25)29-26-18-14-21-30-26/h13-14,18-24,29H,6-12,15-17H2,1-5H3 |
| InChIKey | FYSIMIUTJWPPNN-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.81 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine?
The IUPAC name of N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine (CID 69178137) is N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine.
What is the SMILES notation for N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine?
The canonical SMILES for N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine is CC(C)CCCCCCCC(C)CCCC=CC(C)(C)c1ccsc1Nc1cccs1.
What is the InChIKey of N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine?
The InChIKey is FYSIMIUTJWPPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45NS2/c1-23(2)15-10-7-6-8-11-16-24(3)17-12-9-13-20-28(4,5)25-19-22-31-27(25)29-26-18-14-21-30-26/h13-14,18-24,29H,6-12,15-17H2,1-5H3.
What are the key properties of N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine?
N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine has a molecular weight of 459.81 g/mol, XLogP of 10.58, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-thiophen-2-yl-3-(2,8,16-trimethylheptadec-3-en-2-yl)thiophen-2-amine is sourced from PubChem (CID 69178137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).