About [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate
[(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate (PubChem CID 69178219) has the molecular formula C13H21NO4
and a molecular weight of 255.31 g/mol. Its IUPAC name is [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate |
| PubChem CID | 69178219 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H21NO4/c1-9(15)17-11-7-5-10(6-8-11)14-12(16)18-13(2,3)4/h5,7,10-11H,6,8H2,1-4H3,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | RQDLDEXMWTXBKX-QWRGUYRKSA-N |
| XLogP | 2.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate?
The IUPAC name of [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate (CID 69178219) is [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate.
What is the SMILES notation for [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate?
The canonical SMILES for [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate is CC(=O)O[C@H]1C=C[C@H](NC(=O)OC(C)(C)C)CC1.
What is the InChIKey of [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate?
The InChIKey is RQDLDEXMWTXBKX-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H21NO4/c1-9(15)17-11-7-5-10(6-8-11)14-12(16)18-13(2,3)4/h5,7,10-11H,6,8H2,1-4H3,(H,14,16)/t10-,11-/m0/s1.
What are the key properties of [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate?
[(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate has a molecular weight of 255.31 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-2-en-1-yl] acetate is sourced from PubChem (CID 69178219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).