About (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide
(2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide (PubChem CID 6917830) has the molecular formula C18H30N4O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide.
Molecular Properties
| Compound Name | (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide |
| PubChem CID | 6917830 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)NC12CC3CC(CC(C3)C1)C2)C(N)=O |
| InChI | InChI=1S/C18H30N4O3/c1-10(19)17(25)21-14(16(20)24)2-3-15(23)22-18-7-11-4-12(8-18)6-13(5-11)9-18/h10-14H,2-9,19H2,1H3,(H2,20,24)(H,21,25)(H,22,23)/t10-,11?,12?,13?,14+,18?/m0/s1 |
| InChIKey | MXWDHKDTQAPDQD-WZDKYTMSSA-N |
| XLogP | 0.17 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide?
The IUPAC name of (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide (CID 6917830) is (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide.
What is the SMILES notation for (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide?
The canonical SMILES for (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide is C[C@H](N)C(=O)N[C@H](CCC(=O)NC12CC3CC(CC(C3)C1)C2)C(N)=O.
What is the InChIKey of (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide?
The InChIKey is MXWDHKDTQAPDQD-WZDKYTMSSA-N. The full InChI is InChI=1S/C18H30N4O3/c1-10(19)17(25)21-14(16(20)24)2-3-15(23)22-18-7-11-4-12(8-18)6-13(5-11)9-18/h10-14H,2-9,19H2,1H3,(H2,20,24)(H,21,25)(H,22,23)/t10-,11?,12?,13?,14+,18?/m0/s1.
What are the key properties of (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide?
(2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide has a molecular weight of 350.46 g/mol, XLogP of 0.17, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N'-(1-adamantyl)-2-[[(2S)-2-aminopropanoyl]amino]pentanediamide is sourced from PubChem (CID 6917830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).