C8H11NO2 — CID 69178328
4a,5,6,7-tetrahydro-4H-1,4-benzoxazin-3-one (PubChem CID 69178328) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 4a,5,6,7-tetrahydro-4H-1,4-benzoxazin-3-one.
| Compound Name | 4a,5,6,7-tetrahydro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 69178328 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4a,5,6,7-tetrahydro-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COC2=CCCCC2N1 |
| InChI | InChI=1S/C8H11NO2/c10-8-5-11-7-4-2-1-3-6(7)9-8/h4,6H,1-3,5H2,(H,9,10) |
| InChIKey | WVUAGJIKMVMEPC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |