About 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride
8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride (PubChem CID 6917843) has the molecular formula C22H38ClNO5
and a molecular weight of 432.00 g/mol. Its IUPAC name is 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride |
| PubChem CID | 6917843 |
| Molecular Formula | C22H38ClNO5 |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride |
| SMILES | CCN(CC)CCCCCCCCOC(=O)c1cc(OC)c(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C22H37NO5.ClH/c1-6-23(7-2)14-12-10-8-9-11-13-15-28-22(24)18-16-19(25-3)21(27-5)20(17-18)26-4;/h16-17H,6-15H2,1-5H3;1H |
| InChIKey | KFJZVXKPPQIYCG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride?
The IUPAC name of 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride (CID 6917843) is 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride.
What is the SMILES notation for 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride?
The canonical SMILES for 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride is CCN(CC)CCCCCCCCOC(=O)c1cc(OC)c(OC)c(OC)c1.Cl.
What is the InChIKey of 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride?
The InChIKey is KFJZVXKPPQIYCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37NO5.ClH/c1-6-23(7-2)14-12-10-8-9-11-13-15-28-22(24)18-16-19(25-3)21(27-5)20(17-18)26-4;/h16-17H,6-15H2,1-5H3;1H.
What are the key properties of 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride?
8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride has a molecular weight of 432.00 g/mol, XLogP of 4.97, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(diethylamino)octyl 3,4,5-trimethoxybenzoate;hydrochloride is sourced from PubChem (CID 6917843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).