C37H44FN5O3Si — CID 69178430
2-[4-[[1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-2-(2-trimethylsilylethoxy)ethyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]butyl]isoindole-1,3-dione (PubChem CID 69178430) has the molecular formula C37H44FN5O3Si and a molecular weight of 653.88 g/mol. Its IUPAC name is 2-[4-[[1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-2-(2-trimethylsilylethoxy)ethyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-2-(2-trimethylsilylethoxy)ethyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69178430 |
| Molecular Formula | C37H44FN5O3Si |
| Molecular Weight | 653.88 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | 2-[4-[[1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-2-(2-trimethylsilylethoxy)ethyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]butyl]isoindole-1,3-dione |
| SMILES | C[Si](C)(C)CCOCC(c1ncc(-c2ccc(F)cc2)[nH]1)N(CCCCN1C(=O)c2ccccc2C1=O)C1CCCc2cccnc21 |
| InChI | InChI=1S/C37H44FN5O3Si/c1-47(2,3)23-22-46-25-33(35-40-24-31(41-35)26-15-17-28(38)18-16-26)42(32-14-8-10-27-11-9-19-39-34(27)32)20-6-7-21-43-36(44)29-12-4-5-13-30(29)37(43)45/h4-5,9,11-13,15-19,24,32-33H,6-8,10,14,20-23,25H2,1-3H3,(H,40,41) |
| InChIKey | BONJPWHEVDAYCO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.88 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|