About 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine
1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine (PubChem CID 69178714) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine.
Molecular Properties
| Compound Name | 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine |
| PubChem CID | 69178714 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine |
| SMILES | NCc1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H8N4/c8-2-5-1-6-4-10-11-7(6)9-3-5/h1,3-4H,2,8H2,(H,9,10,11) |
| InChIKey | JAZARHNKVZGLBJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine?
The IUPAC name of 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine (CID 69178714) is 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine.
What is the SMILES notation for 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine?
The canonical SMILES for 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine is NCc1cnc2[nH]ncc2c1.
What is the InChIKey of 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine?
The InChIKey is JAZARHNKVZGLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c8-2-5-1-6-4-10-11-7(6)9-3-5/h1,3-4H,2,8H2,(H,9,10,11).
What are the key properties of 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine?
1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine has a molecular weight of 148.17 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[5,4-b]pyridin-5-ylmethanamine is sourced from PubChem (CID 69178714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).