About cyclohexylazanium;2,2,2-trifluoroacetate
cyclohexylazanium;2,2,2-trifluoroacetate (PubChem CID 69179131) has the molecular formula C8H14F3NO2
and a molecular weight of 213.20 g/mol. Its IUPAC name is cyclohexylazanium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | cyclohexylazanium;2,2,2-trifluoroacetate |
| PubChem CID | 69179131 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | cyclohexylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C6H13N.C2HF3O2/c7-6-4-2-1-3-5-6;3-2(4,5)1(6)7/h6H,1-5,7H2;(H,6,7) |
| InChIKey | GUEYGXWTUFVPOM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexylazanium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylazanium;2,2,2-trifluoroacetate?
The IUPAC name of cyclohexylazanium;2,2,2-trifluoroacetate (CID 69179131) is cyclohexylazanium;2,2,2-trifluoroacetate.
What is the SMILES notation for cyclohexylazanium;2,2,2-trifluoroacetate?
The canonical SMILES for cyclohexylazanium;2,2,2-trifluoroacetate is O=C([O-])C(F)(F)F.[NH3+]C1CCCCC1.
What is the InChIKey of cyclohexylazanium;2,2,2-trifluoroacetate?
The InChIKey is GUEYGXWTUFVPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2HF3O2/c7-6-4-2-1-3-5-6;3-2(4,5)1(6)7/h6H,1-5,7H2;(H,6,7).
What are the key properties of cyclohexylazanium;2,2,2-trifluoroacetate?
cyclohexylazanium;2,2,2-trifluoroacetate has a molecular weight of 213.20 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylazanium;2,2,2-trifluoroacetate is sourced from PubChem (CID 69179131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).