C22H28O7 — CID 6917920
(2R,5R)-2,5-bis(3,4,5-trimethoxyphenyl)oxolane (PubChem CID 6917920) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(3,4,5-trimethoxyphenyl)oxolane.
| Compound Name | (2R,5R)-2,5-bis(3,4,5-trimethoxyphenyl)oxolane |
|---|---|
| PubChem CID | 6917920 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (2R,5R)-2,5-bis(3,4,5-trimethoxyphenyl)oxolane |
| SMILES | COc1cc([C@H]2CC[C@H](c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OC |
| InChI | InChI=1S/C22H28O7/c1-23-17-9-13(10-18(24-2)21(17)27-5)15-7-8-16(29-15)14-11-19(25-3)22(28-6)20(12-14)26-4/h9-12,15-16H,7-8H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | YCCPYTPBHUIHGW-HZPDHXFCSA-N |
| XLogP | 4.33 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |