About 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide
3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide (PubChem CID 69179670) has the molecular formula C18H28N2O4S
and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide |
| PubChem CID | 69179670 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(Cc1cc(S(C)(=O)=O)ccc1NCC1(O)CCCC1)C(N)=O |
| InChI | InChI=1S/C18H28N2O4S/c1-17(2,16(19)21)11-13-10-14(25(3,23)24)6-7-15(13)20-12-18(22)8-4-5-9-18/h6-7,10,20,22H,4-5,8-9,11-12H2,1-3H3,(H2,19,21) |
| InChIKey | HWJFSBROQKDXBK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide?
The IUPAC name of 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide (CID 69179670) is 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide.
What is the SMILES notation for 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide?
The canonical SMILES for 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide is CC(C)(Cc1cc(S(C)(=O)=O)ccc1NCC1(O)CCCC1)C(N)=O.
What is the InChIKey of 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide?
The InChIKey is HWJFSBROQKDXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O4S/c1-17(2,16(19)21)11-13-10-14(25(3,23)24)6-7-15(13)20-12-18(22)8-4-5-9-18/h6-7,10,20,22H,4-5,8-9,11-12H2,1-3H3,(H2,19,21).
What are the key properties of 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide?
3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide has a molecular weight of 368.50 g/mol, XLogP of 1.86, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1-hydroxycyclopentyl)methylamino]-5-methylsulfonylphenyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 69179670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).