C13H17FN4O — CID 69180081
7-[(3R,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 69180081) has the molecular formula C13H17FN4O and a molecular weight of 264.30 g/mol. Its IUPAC name is 7-[(3R,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(3R,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 69180081 |
| Molecular Formula | C13H17FN4O |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 7-[(3R,4R,5R)-5-ethyl-3-fluoro-4-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC[C@H]1OC(c2ccc3c(N)ncnn23)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/C13H17FN4O/c1-3-10-7(2)11(14)12(19-10)8-4-5-9-13(15)16-6-17-18(8)9/h4-7,10-12H,3H2,1-2H3,(H2,15,16,17)/t7-,10-,11-,12?/m1/s1 |
| InChIKey | QICSDBKWVFBRRG-AGVQNCPFSA-N |
| XLogP | 2.14 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |