About 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride
2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride (PubChem CID 6918035) has the molecular formula C11H19ClN4
and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride |
| PubChem CID | 6918035 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride |
| SMILES | Cc1cccc(C)c1N/N=C(/N)N(C)C.Cl |
| InChI | InChI=1S/C11H18N4.ClH/c1-8-6-5-7-9(2)10(8)13-14-11(12)15(3)4;/h5-7,13H,1-4H3,(H2,12,14);1H |
| InChIKey | LBTUHNNCEFYFFH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride?
The IUPAC name of 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride (CID 6918035) is 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride.
What is the SMILES notation for 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride?
The canonical SMILES for 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride is Cc1cccc(C)c1N/N=C(/N)N(C)C.Cl.
What is the InChIKey of 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride?
The InChIKey is LBTUHNNCEFYFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4.ClH/c1-8-6-5-7-9(2)10(8)13-14-11(12)15(3)4;/h5-7,13H,1-4H3,(H2,12,14);1H.
What are the key properties of 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride?
2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride has a molecular weight of 242.75 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylanilino)-1,1-dimethylguanidine;hydrochloride is sourced from PubChem (CID 6918035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).