C24H26N4O — CID 69180417
1-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1-quinolin-8-ylurea (PubChem CID 69180417) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1-quinolin-8-ylurea.
| Compound Name | 1-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1-quinolin-8-ylurea |
|---|---|
| PubChem CID | 69180417 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-(3-cyclobutyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-1-quinolin-8-ylurea |
| SMILES | NC(=O)N(c1ccc2c(c1)CCN(C1CCC1)CC2)c1cccc2cccnc12 |
| InChI | InChI=1S/C24H26N4O/c25-24(29)28(22-8-1-4-18-5-3-13-26-23(18)22)21-10-9-17-11-14-27(20-6-2-7-20)15-12-19(17)16-21/h1,3-5,8-10,13,16,20H,2,6-7,11-12,14-15H2,(H2,25,29) |
| InChIKey | QJURBXQCLGACRM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |