About 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione
1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione (PubChem CID 69180525) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione |
| PubChem CID | 69180525 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(C(O)C=CO)C(=O)N1 |
| InChI | InChI=1S/C6H8N2O4/c9-2-1-5(11)8-3-4(10)7-6(8)12/h1-2,5,9,11H,3H2,(H,7,10,12) |
| InChIKey | ZIHSSEUTHLQBSI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione?
The IUPAC name of 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione (CID 69180525) is 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione.
What is the SMILES notation for 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione?
The canonical SMILES for 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione is O=C1CN(C(O)C=CO)C(=O)N1.
What is the InChIKey of 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione?
The InChIKey is ZIHSSEUTHLQBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c9-2-1-5(11)8-3-4(10)7-6(8)12/h1-2,5,9,11H,3H2,(H,7,10,12).
What are the key properties of 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione?
1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione has a molecular weight of 172.14 g/mol, XLogP of -1.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dihydroxyprop-2-enyl)imidazolidine-2,4-dione is sourced from PubChem (CID 69180525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).