C25H26FN3O8S — CID 6918060
bis((Z)-but-2-enedioic acid);10-fluoro-3-methyl-7-thiophen-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine (PubChem CID 6918060) has the molecular formula C25H26FN3O8S and a molecular weight of 547.56 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);10-fluoro-3-methyl-7-thiophen-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine.
| Compound Name | bis((Z)-but-2-enedioic acid);10-fluoro-3-methyl-7-thiophen-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 6918060 |
| Molecular Formula | C25H26FN3O8S |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);10-fluoro-3-methyl-7-thiophen-2-yl-2,4,4a,5-tetrahydro-1H-pyrazino[1,2-a][1,4]benzodiazepine |
| SMILES | CN1CCN2c3cc(F)ccc3C(c3cccs3)=NCC2C1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H18FN3S.2C4H4O4/c1-20-6-7-21-13(11-20)10-19-17(16-3-2-8-22-16)14-5-4-12(18)9-15(14)21;2*5-3(6)1-2-4(7)8/h2-5,8-9,13H,6-7,10-11H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | RZJUIBXCUCYJRN-SPIKMXEPSA-N |
| XLogP | 2.28 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|